About (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate
(2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate (PubChem CID 123142218) has the molecular formula C13H16N2O6
and a molecular weight of 296.28 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate.
Molecular Properties
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate |
| PubChem CID | 123142218 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate |
| SMILES | O=C(CCCCN1C(=O)C=CC1=O)ON1C(=O)CCC1O |
| InChI | InChI=1S/C13H16N2O6/c16-9-4-5-10(17)14(9)8-2-1-3-13(20)21-15-11(18)6-7-12(15)19/h4-5,11,18H,1-3,6-8H2 |
| InChIKey | VNDFRFFMJUZLMU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate?
The IUPAC name of (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate (CID 123142218) is (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate.
What is the SMILES notation for (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate?
The canonical SMILES for (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate is O=C(CCCCN1C(=O)C=CC1=O)ON1C(=O)CCC1O.
What is the InChIKey of (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate?
The InChIKey is VNDFRFFMJUZLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O6/c16-9-4-5-10(17)14(9)8-2-1-3-13(20)21-15-11(18)6-7-12(15)19/h4-5,11,18H,1-3,6-8H2.
What are the key properties of (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate?
(2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate has a molecular weight of 296.28 g/mol, XLogP of -0.52, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-5-oxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)pentanoate is sourced from PubChem (CID 123142218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).