C22H24O5 — CID 123142462
3,4-dimethyl-3,4-dihydrochromen-2-one;6-hydroxy-3,4-dimethyl-3,4-dihydrochromen-2-one (PubChem CID 123142462) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3,4-dimethyl-3,4-dihydrochromen-2-one;6-hydroxy-3,4-dimethyl-3,4-dihydrochromen-2-one.
| Compound Name | 3,4-dimethyl-3,4-dihydrochromen-2-one;6-hydroxy-3,4-dimethyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 123142462 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3,4-dimethyl-3,4-dihydrochromen-2-one;6-hydroxy-3,4-dimethyl-3,4-dihydrochromen-2-one |
| SMILES | CC1C(=O)Oc2ccc(O)cc2C1C.CC1C(=O)Oc2ccccc2C1C |
| InChI | InChI=1S/C11H12O3.C11H12O2/c1-6-7(2)11(13)14-10-4-3-8(12)5-9(6)10;1-7-8(2)11(12)13-10-6-4-3-5-9(7)10/h3-7,12H,1-2H3;3-8H,1-2H3 |
| InChIKey | LVQJUJXMQJRETF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|