C10H12N2O — CID 123142500
2-hepta-1,3,5-trien-4-yl-5-methyl-1,3,4-oxadiazole (PubChem CID 123142500) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-hepta-1,3,5-trien-4-yl-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-hepta-1,3,5-trien-4-yl-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 123142500 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-hepta-1,3,5-trien-4-yl-5-methyl-1,3,4-oxadiazole |
| SMILES | C=CC=C(C=CC)c1nnc(C)o1 |
| InChI | InChI=1S/C10H12N2O/c1-4-6-9(7-5-2)10-12-11-8(3)13-10/h4-7H,1H2,2-3H3 |
| InChIKey | LLJLGFUQAWWCRO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|