C18H30F3NO7 — CID 123142843
2,2,2-trifluoro-N-[2,4,4-trimethyl-6-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]hexan-2-yl]acetamide (PubChem CID 123142843) has the molecular formula C18H30F3NO7 and a molecular weight of 429.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2,4,4-trimethyl-6-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]hexan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2,4,4-trimethyl-6-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]hexan-2-yl]acetamide |
|---|---|
| PubChem CID | 123142843 |
| Molecular Formula | C18H30F3NO7 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 2,2,2-trifluoro-N-[2,4,4-trimethyl-6-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]hexan-2-yl]acetamide |
| SMILES | CC(C)(CCOC1OC2(O)C(CO)C(O)C(O)C12)CC(C)(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H30F3NO7/c1-15(2,8-16(3,4)22-14(26)18(19,20)21)5-6-28-13-10-12(25)11(24)9(7-23)17(10,27)29-13/h9-13,23-25,27H,5-8H2,1-4H3,(H,22,26) |
| InChIKey | XFTRNHRDEDTRCC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |