About methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium
methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium (PubChem CID 123143010) has the molecular formula C11H17N2+
and a molecular weight of 177.27 g/mol. Its IUPAC name is methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium.
Molecular Properties
| Compound Name | methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium |
| PubChem CID | 123143010 |
| Molecular Formula | C11H17N2+ |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium |
| SMILES | C=C(C)/[N+](C)=C/C1=C(C)CNC=C1 |
| InChI | InChI=1S/C11H17N2/c1-9(2)13(4)8-11-5-6-12-7-10(11)3/h5-6,8,12H,1,7H2,2-4H3/q+1/b13-8+ |
| InChIKey | CNKPVXPJDWFDHD-MDWZMJQESA-N |
| XLogP | 1.67 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium?
The IUPAC name of methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium (CID 123143010) is methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium.
What is the SMILES notation for methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium?
The canonical SMILES for methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium is C=C(C)/[N+](C)=C/C1=C(C)CNC=C1.
What is the InChIKey of methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium?
The InChIKey is CNKPVXPJDWFDHD-MDWZMJQESA-N. The full InChI is InChI=1S/C11H17N2/c1-9(2)13(4)8-11-5-6-12-7-10(11)3/h5-6,8,12H,1,7H2,2-4H3/q+1/b13-8+.
What are the key properties of methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium?
methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium has a molecular weight of 177.27 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(3-methyl-1,2-dihydropyridin-4-yl)methylidene]-prop-1-en-2-ylazanium is sourced from PubChem (CID 123143010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).