About 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane
5-(2-fluorobut-2-enyl)-2,4-dimethyloxane (PubChem CID 123143055) has the molecular formula C11H19FO
and a molecular weight of 186.27 g/mol. Its IUPAC name is 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane.
Molecular Properties
| Compound Name | 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane |
| PubChem CID | 123143055 |
| Molecular Formula | C11H19FO |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane |
| SMILES | CC=C(F)CC1COC(C)CC1C |
| InChI | InChI=1S/C11H19FO/c1-4-11(12)6-10-7-13-9(3)5-8(10)2/h4,8-10H,5-7H2,1-3H3 |
| InChIKey | WSKWPRVHCHCNMG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane?
The IUPAC name of 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane (CID 123143055) is 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane.
What is the SMILES notation for 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane?
The canonical SMILES for 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane is CC=C(F)CC1COC(C)CC1C.
What is the InChIKey of 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane?
The InChIKey is WSKWPRVHCHCNMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FO/c1-4-11(12)6-10-7-13-9(3)5-8(10)2/h4,8-10H,5-7H2,1-3H3.
What are the key properties of 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane?
5-(2-fluorobut-2-enyl)-2,4-dimethyloxane has a molecular weight of 186.27 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorobut-2-enyl)-2,4-dimethyloxane is sourced from PubChem (CID 123143055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).