C32H42F2N2O4 — CID 123143374
N-(18-cyano-1,2,8,8,15,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl)-2,2-difluoropropanamide (PubChem CID 123143374) has the molecular formula C32H42F2N2O4 and a molecular weight of 556.69 g/mol. Its IUPAC name is N-(18-cyano-1,2,8,8,15,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl)-2,2-difluoropropanamide.
| Compound Name | N-(18-cyano-1,2,8,8,15,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl)-2,2-difluoropropanamide |
|---|---|
| PubChem CID | 123143374 |
| Molecular Formula | C32H42F2N2O4 |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | N-(18-cyano-1,2,8,8,15,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-en-5-yl)-2,2-difluoropropanamide |
| SMILES | CC1C(=O)C2(C#N)OC2C2(C)C3=CC(=O)C4C5CC(C)(C)CCC5(NC(=O)C(C)(F)F)CCC4(C)C3(C)CCC12 |
| InChI | InChI=1S/C32H42F2N2O4/c1-17-18-8-9-27(4)21(29(18,6)24-32(16-35,40-24)23(17)38)14-20(37)22-19-15-26(2,3)10-12-31(19,13-11-28(22,27)5)36-25(39)30(7,33)34/h14,17-19,22,24H,8-13,15H2,1-7H3,(H,36,39) |
| InChIKey | ULLHJZFOMGGPQN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|