C25H21O5S- — CID 123143597
4-[3-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-4-methylphenyl]benzenesulfinate (PubChem CID 123143597) has the molecular formula C25H21O5S- and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[3-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-4-methylphenyl]benzenesulfinate.
| Compound Name | 4-[3-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-4-methylphenyl]benzenesulfinate |
|---|---|
| PubChem CID | 123143597 |
| Molecular Formula | C25H21O5S- |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-[3-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-4-methylphenyl]benzenesulfinate |
| SMILES | Cc1ccc(-c2ccc(S(=O)[O-])cc2)cc1CC(=O)C1(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C25H22O5S/c1-16-2-3-18(17-4-7-21(8-5-17)31(27)28)12-19(16)13-24(26)25(10-11-25)20-6-9-22-23(14-20)30-15-29-22/h2-9,12,14H,10-11,13,15H2,1H3,(H,27,28)/p-1 |
| InChIKey | PTLBQXQWSPMFMS-UHFFFAOYSA-M |
| XLogP | 4.47 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|