C16H16O3 — CID 123144180
tetracyclo[10.2.2.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaene-3,5,10-triol (PubChem CID 123144180) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is tetracyclo[10.2.2.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaene-3,5,10-triol.
| Compound Name | tetracyclo[10.2.2.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaene-3,5,10-triol |
|---|---|
| PubChem CID | 123144180 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | tetracyclo[10.2.2.02,11.04,9]hexadeca-2,4(9),5,7,10-pentaene-3,5,10-triol |
| SMILES | Oc1c2c(c(O)c3c(O)cccc13)C1CCC2CC1 |
| InChI | InChI=1S/C16H16O3/c17-11-3-1-2-10-14(11)16(19)13-9-6-4-8(5-7-9)12(13)15(10)18/h1-3,8-9,17-19H,4-7H2 |
| InChIKey | QOCWFDJUXPLBAS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|