About 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane
5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane (PubChem CID 123144400) has the molecular formula C20H24N2O4-2
and a molecular weight of 356.42 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane.
Molecular Properties
| Compound Name | 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane |
| PubChem CID | 123144400 |
| Molecular Formula | C20H24N2O4-2 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane |
| SMILES | CC.CC.Cc1cc(C)cc(/N=N/c2cc(C(=O)[O-])cc(C(=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H14N2O4.2C2H6/c1-9-3-10(2)5-13(4-9)17-18-14-7-11(15(19)20)6-12(8-14)16(21)22;2*1-2/h3-8H,1-2H3,(H,19,20)(H,21,22);2*1-2H3/p-2/b18-17+;; |
| InChIKey | VTRRXXUCPQWEOO-QIKYXUGXSA-L |
| XLogP | 3.50 |
| TPSA | 104.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane?
The IUPAC name of 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane (CID 123144400) is 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane.
What is the SMILES notation for 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane?
The canonical SMILES for 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane is CC.CC.Cc1cc(C)cc(/N=N/c2cc(C(=O)[O-])cc(C(=O)[O-])c2)c1.
What is the InChIKey of 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane?
The InChIKey is VTRRXXUCPQWEOO-QIKYXUGXSA-L. The full InChI is InChI=1S/C16H14N2O4.2C2H6/c1-9-3-10(2)5-13(4-9)17-18-14-7-11(15(19)20)6-12(8-14)16(21)22;2*1-2/h3-8H,1-2H3,(H,19,20)(H,21,22);2*1-2H3/p-2/b18-17+;;.
What are the key properties of 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane?
5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane has a molecular weight of 356.42 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethylphenyl)diazenyl]benzene-1,3-dicarboxylate;ethane is sourced from PubChem (CID 123144400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).