C42H28N4S — CID 123144484
10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-17-methyl-14-thia-10-azapentacyclo[11.9.0.03,11.04,9.015,20]docosa-1,3(11),4,6,8,12,15(20),16,18,21-decaene (PubChem CID 123144484) has the molecular formula C42H28N4S and a molecular weight of 620.78 g/mol. Its IUPAC name is 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-17-methyl-14-thia-10-azapentacyclo[11.9.0.03,11.04,9.015,20]docosa-1,3(11),4,6,8,12,15(20),16,18,21-decaene.
| Compound Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-17-methyl-14-thia-10-azapentacyclo[11.9.0.03,11.04,9.015,20]docosa-1,3(11),4,6,8,12,15(20),16,18,21-decaene |
|---|---|
| PubChem CID | 123144484 |
| Molecular Formula | C42H28N4S |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-17-methyl-14-thia-10-azapentacyclo[11.9.0.03,11.04,9.015,20]docosa-1,3(11),4,6,8,12,15(20),16,18,21-decaene |
| SMILES | Cc1ccc2c(c1)Sc1cc3c(cc1C=C2)c1ccccc1n3-c1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C42H28N4S/c1-27-19-20-28-21-22-31-25-35-34-17-8-9-18-36(34)46(37(35)26-39(31)47-38(28)23-27)33-16-10-15-32(24-33)42-44-40(29-11-4-2-5-12-29)43-41(45-42)30-13-6-3-7-14-30/h2-26H,1H3 |
| InChIKey | LRWDGORKVYCYRY-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|