About 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone
1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone (PubChem CID 123144780) has the molecular formula C15H19FN2O
and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone |
| PubChem CID | 123144780 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2c[nH]c3c2=CCC(F)C=3)CC1 |
| InChI | InChI=1S/C15H19FN2O/c1-10(19)18-6-4-11(5-7-18)14-9-17-15-8-12(16)2-3-13(14)15/h3,8-9,11-12,17H,2,4-7H2,1H3 |
| InChIKey | GWHWHMYUBGKMMD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone (CID 123144780) is 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone is CC(=O)N1CCC(c2c[nH]c3c2=CCC(F)C=3)CC1.
What is the InChIKey of 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone?
The InChIKey is GWHWHMYUBGKMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O/c1-10(19)18-6-4-11(5-7-18)14-9-17-15-8-12(16)2-3-13(14)15/h3,8-9,11-12,17H,2,4-7H2,1H3.
What are the key properties of 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone?
1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone has a molecular weight of 262.33 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-fluoro-5,6-dihydro-1H-indol-3-yl)piperidin-1-yl]ethanone is sourced from PubChem (CID 123144780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).