C18H34O12Si4 — CID 123145346
disilyl 2-[6-(1,6-dioxo-1,6-disilyloxyhexan-2-yl)oxy-6-oxohexanoyl]oxyhexanedioate (PubChem CID 123145346) has the molecular formula C18H34O12Si4 and a molecular weight of 554.80 g/mol. Its IUPAC name is disilyl 2-[6-(1,6-dioxo-1,6-disilyloxyhexan-2-yl)oxy-6-oxohexanoyl]oxyhexanedioate.
| Compound Name | disilyl 2-[6-(1,6-dioxo-1,6-disilyloxyhexan-2-yl)oxy-6-oxohexanoyl]oxyhexanedioate |
|---|---|
| PubChem CID | 123145346 |
| Molecular Formula | C18H34O12Si4 |
| Molecular Weight | 554.80 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | disilyl 2-[6-(1,6-dioxo-1,6-disilyloxyhexan-2-yl)oxy-6-oxohexanoyl]oxyhexanedioate |
| SMILES | O=C(CCCC(OC(=O)CCCCC(=O)OC(CCCC(=O)O[SiH3])C(=O)O[SiH3])C(=O)O[SiH3])O[SiH3] |
| InChI | InChI=1S/C18H34O12Si4/c19-13(25-11(17(23)29-33)5-3-9-15(21)27-31)7-1-2-8-14(20)26-12(18(24)30-34)6-4-10-16(22)28-32/h11-12H,1-10H2,31-34H3 |
| InChIKey | NXTFEHKDDRICFS-UHFFFAOYSA-N |
| XLogP | -3.99 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.80 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|