C17H5ClF13N5 — CID 123145755
[2-[2-chloro-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-3-yl]diazene (PubChem CID 123145755) has the molecular formula C17H5ClF13N5 and a molecular weight of 561.69 g/mol. Its IUPAC name is [2-[2-chloro-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-3-yl]diazene.
| Compound Name | [2-[2-chloro-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-3-yl]diazene |
|---|---|
| PubChem CID | 123145755 |
| Molecular Formula | C17H5ClF13N5 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.00 |
| IUPAC Name | [2-[2-chloro-4-(trifluoromethyl)phenyl]-6-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-3-yl]diazene |
| SMILES | [H]/N=N/c1c2c(C(F)(F)F)cc(C(F)(F)C(F)(F)C(F)(F)F)nc2nn1-c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H5ClF13N5/c18-7-3-5(14(21,22)23)1-2-8(7)36-12(34-32)10-6(15(24,25)26)4-9(33-11(10)35-36)13(19,20)16(27,28)17(29,30)31/h1-4,32H/b34-32+ |
| InChIKey | KCCSHDOHYQTVFU-NWBJSICCSA-N |
| XLogP | 8.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|