C33H74O4Si3 — CID 123146128
3-[dimethyl(3,5,5,7,7-pentaethylnonan-3-yl)silyl]oxypentan-3-yl-dimethyl-(2-trimethoxysilylethyl)silane (PubChem CID 123146128) has the molecular formula C33H74O4Si3 and a molecular weight of 619.21 g/mol. Its IUPAC name is 3-[dimethyl(3,5,5,7,7-pentaethylnonan-3-yl)silyl]oxypentan-3-yl-dimethyl-(2-trimethoxysilylethyl)silane.
| Compound Name | 3-[dimethyl(3,5,5,7,7-pentaethylnonan-3-yl)silyl]oxypentan-3-yl-dimethyl-(2-trimethoxysilylethyl)silane |
|---|---|
| PubChem CID | 123146128 |
| Molecular Formula | C33H74O4Si3 |
| Molecular Weight | 619.21 g/mol |
| Exact Mass | 618.49 |
| IUPAC Name | 3-[dimethyl(3,5,5,7,7-pentaethylnonan-3-yl)silyl]oxypentan-3-yl-dimethyl-(2-trimethoxysilylethyl)silane |
| SMILES | CCC(CC)(CC)CC(CC)(CC)CC(CC)(CC)[Si](C)(C)OC(CC)(CC)[Si](C)(C)CC[Si](OC)(OC)OC |
| InChI | InChI=1S/C33H74O4Si3/c1-17-30(18-2,19-3)28-31(20-4,21-5)29-32(22-6,23-7)39(15,16)37-33(24-8,25-9)38(13,14)26-27-40(34-10,35-11)36-12/h17-29H2,1-16H3 |
| InChIKey | VWGVGHAFSJOXLQ-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.21 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|