C26H14F18NOP — CID 123146141
2-pyridin-2-ylpropan-2-yloxy-bis[2,4,6-tris(trifluoromethyl)phenyl]phosphane (PubChem CID 123146141) has the molecular formula C26H14F18NOP and a molecular weight of 729.34 g/mol. Its IUPAC name is 2-pyridin-2-ylpropan-2-yloxy-bis[2,4,6-tris(trifluoromethyl)phenyl]phosphane.
| Compound Name | 2-pyridin-2-ylpropan-2-yloxy-bis[2,4,6-tris(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 123146141 |
| Molecular Formula | C26H14F18NOP |
| Molecular Weight | 729.34 g/mol |
| Exact Mass | 729.05 |
| IUPAC Name | 2-pyridin-2-ylpropan-2-yloxy-bis[2,4,6-tris(trifluoromethyl)phenyl]phosphane |
| SMILES | CC(C)(OP(c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F)c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F)c1ccccn1 |
| InChI | InChI=1S/C26H14F18NOP/c1-20(2,17-5-3-4-6-45-17)46-47(18-13(23(33,34)35)7-11(21(27,28)29)8-14(18)24(36,37)38)19-15(25(39,40)41)9-12(22(30,31)32)10-16(19)26(42,43)44/h3-10H,1-2H3 |
| InChIKey | XATUOWPNRFGYDL-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.34 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|