C12H24N4OS2 — CID 123146265
N-[1-(disulfanyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 123146265) has the molecular formula C12H24N4OS2 and a molecular weight of 304.49 g/mol. Its IUPAC name is N-[1-(disulfanyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[1-(disulfanyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 123146265 |
| Molecular Formula | C12H24N4OS2 |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[1-(disulfanyl)piperidin-3-yl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)NC2CCCN(SS)C2)CC1 |
| InChI | InChI=1S/C12H24N4OS2/c1-14-5-7-15(8-6-14)10-12(17)13-11-3-2-4-16(9-11)19-18/h11,18H,2-10H2,1H3,(H,13,17) |
| InChIKey | TUSTZZSYFPQICV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|