C19H18F2N4O2 — CID 123146416
11-[3-fluoro-4-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 123146416) has the molecular formula C19H18F2N4O2 and a molecular weight of 372.38 g/mol. Its IUPAC name is 11-[3-fluoro-4-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-[3-fluoro-4-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 123146416 |
| Molecular Formula | C19H18F2N4O2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 11-[3-fluoro-4-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | Cn1c2c(c3ccc(Nc4ccc(OCCF)c(F)c4)nc31)C(=O)NCC2 |
| InChI | InChI=1S/C19H18F2N4O2/c1-25-14-6-8-22-19(26)17(14)12-3-5-16(24-18(12)25)23-11-2-4-15(13(21)10-11)27-9-7-20/h2-5,10H,6-9H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | VBKMZQDYIFSSBI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |