C8H9Cl2N — CID 123146954
2,7-dichloro-3-methyl-3,4-dihydroazocine (PubChem CID 123146954) has the molecular formula C8H9Cl2N and a molecular weight of 190.07 g/mol. Its IUPAC name is 2,7-dichloro-3-methyl-3,4-dihydroazocine.
| Compound Name | 2,7-dichloro-3-methyl-3,4-dihydroazocine |
|---|---|
| PubChem CID | 123146954 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | 2,7-dichloro-3-methyl-3,4-dihydroazocine |
| SMILES | CC1CC=CC(Cl)=C/N=C\1Cl |
| InChI | InChI=1S/C8H9Cl2N/c1-6-3-2-4-7(9)5-11-8(6)10/h2,4-6H,3H2,1H3/b4-2?,7-5?,11-8+ |
| InChIKey | PLQRTPDBGYRDDP-CPFOSSIXSA-N |
| XLogP | 3.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |