C25H21FN4OS — CID 123147149
N-[(3-fluorophenyl)methoxy]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 123147149) has the molecular formula C25H21FN4OS and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methoxy]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | N-[(3-fluorophenyl)methoxy]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 123147149 |
| Molecular Formula | C25H21FN4OS |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[(3-fluorophenyl)methoxy]-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | Cc1nc(-c2cccnc2)sc1-c1ccc2c(n1)C(=NOCc1cccc(F)c1)CCC2 |
| InChI | InChI=1S/C25H21FN4OS/c1-16-24(32-25(28-16)19-7-4-12-27-14-19)22-11-10-18-6-3-9-21(23(18)29-22)30-31-15-17-5-2-8-20(26)13-17/h2,4-5,7-8,10-14H,3,6,9,15H2,1H3 |
| InChIKey | NNYUETFDWLFXNN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|