C29H24NO5PS — CID 123147168
2-diphenylphosphoryloxyimino-1-(4-methoxyphenyl)-3-(4-methylsulfanylphenyl)propane-1,3-dione (PubChem CID 123147168) has the molecular formula C29H24NO5PS and a molecular weight of 529.55 g/mol. Its IUPAC name is 2-diphenylphosphoryloxyimino-1-(4-methoxyphenyl)-3-(4-methylsulfanylphenyl)propane-1,3-dione.
| Compound Name | 2-diphenylphosphoryloxyimino-1-(4-methoxyphenyl)-3-(4-methylsulfanylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 123147168 |
| Molecular Formula | C29H24NO5PS |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 2-diphenylphosphoryloxyimino-1-(4-methoxyphenyl)-3-(4-methylsulfanylphenyl)propane-1,3-dione |
| SMILES | COc1ccc(C(=O)C(=NOP(=O)(c2ccccc2)c2ccccc2)C(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C29H24NO5PS/c1-34-23-17-13-21(14-18-23)28(31)27(29(32)22-15-19-26(37-2)20-16-22)30-35-36(33,24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-20H,1-2H3 |
| InChIKey | YAHKHPBMFRVHNO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|