About 1-ethenoxy-N,N-dimethylethenamine
1-ethenoxy-N,N-dimethylethenamine (PubChem CID 123147694) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 1-ethenoxy-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 1-ethenoxy-N,N-dimethylethenamine |
| PubChem CID | 123147694 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 1-ethenoxy-N,N-dimethylethenamine |
| SMILES | CN(C)C(=C)OC=C |
| InChI | InChI=1S/C6H11NO/c1-5-8-6(2)7(3)4/h5H,1-2H2,3-4H3 |
| InChIKey | SJFTWQKGHBIQFO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | 96 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-N,N-dimethylethenamine?
The IUPAC name of 1-ethenoxy-N,N-dimethylethenamine (CID 123147694) is 1-ethenoxy-N,N-dimethylethenamine.
What is the SMILES notation for 1-ethenoxy-N,N-dimethylethenamine?
The canonical SMILES for 1-ethenoxy-N,N-dimethylethenamine is CN(C)C(=C)OC=C.
What is the InChIKey of 1-ethenoxy-N,N-dimethylethenamine?
The InChIKey is SJFTWQKGHBIQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-5-8-6(2)7(3)4/h5H,1-2H2,3-4H3.
What are the key properties of 1-ethenoxy-N,N-dimethylethenamine?
1-ethenoxy-N,N-dimethylethenamine has a molecular weight of 113.16 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-N,N-dimethylethenamine is sourced from PubChem (CID 123147694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).