About N,N'-diethyl-N"-silylmethanetriamine
N,N'-diethyl-N"-silylmethanetriamine (PubChem CID 123147787) has the molecular formula C5H17N3Si
and a molecular weight of 147.30 g/mol. Its IUPAC name is N,N'-diethyl-N"-silylmethanetriamine.
Molecular Properties
| Compound Name | N,N'-diethyl-N"-silylmethanetriamine |
| PubChem CID | 123147787 |
| Molecular Formula | C5H17N3Si |
| Molecular Weight | 147.30 g/mol |
| Exact Mass | 147.12 |
| IUPAC Name | N,N'-diethyl-N"-silylmethanetriamine |
| SMILES | CCNC(N[SiH3])NCC |
| InChI | InChI=1S/C5H17N3Si/c1-3-6-5(8-9)7-4-2/h5-8H,3-4H2,1-2,9H3 |
| InChIKey | NLPNKPBRAASLND-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.30 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diethyl-N"-silylmethanetriamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diethyl-N"-silylmethanetriamine?
The IUPAC name of N,N'-diethyl-N"-silylmethanetriamine (CID 123147787) is N,N'-diethyl-N"-silylmethanetriamine.
What is the SMILES notation for N,N'-diethyl-N"-silylmethanetriamine?
The canonical SMILES for N,N'-diethyl-N"-silylmethanetriamine is CCNC(N[SiH3])NCC.
What is the InChIKey of N,N'-diethyl-N"-silylmethanetriamine?
The InChIKey is NLPNKPBRAASLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H17N3Si/c1-3-6-5(8-9)7-4-2/h5-8H,3-4H2,1-2,9H3.
What are the key properties of N,N'-diethyl-N"-silylmethanetriamine?
N,N'-diethyl-N"-silylmethanetriamine has a molecular weight of 147.30 g/mol, XLogP of -1.64, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diethyl-N"-silylmethanetriamine is sourced from PubChem (CID 123147787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).