C28H36F4N4O5Si — CID 123147871
methyl 3-[[5-[3-fluoro-4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoate (PubChem CID 123147871) has the molecular formula C28H36F4N4O5Si and a molecular weight of 612.70 g/mol. Its IUPAC name is methyl 3-[[5-[3-fluoro-4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[[5-[3-fluoro-4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123147871 |
| Molecular Formula | C28H36F4N4O5Si |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | methyl 3-[[5-[3-fluoro-4-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COc1cc(C)c(-c2ccc(-c3nc(OCC(F)(F)F)n(COCC[Si](C)(C)C)n3)c(F)c2)cn1 |
| InChI | InChI=1S/C28H36F4N4O5Si/c1-18-12-23(40-15-27(2,3)25(37)38-4)33-14-21(18)19-8-9-20(22(29)13-19)24-34-26(41-16-28(30,31)32)36(35-24)17-39-10-11-42(5,6)7/h8-9,12-14H,10-11,15-17H2,1-7H3 |
| InChIKey | MEHIIYSMCGFVOS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|