C16H28N2O — CID 123147882
2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)pent-3-enamide (PubChem CID 123147882) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)pent-3-enamide.
| Compound Name | 2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)pent-3-enamide |
|---|---|
| PubChem CID | 123147882 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)pent-3-enamide |
| SMILES | CC=CC(=CC)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H28N2O/c1-7-9-12(8-2)14(19)17-13-10-15(3,4)18-16(5,6)11-13/h7-9,13,18H,10-11H2,1-6H3,(H,17,19) |
| InChIKey | KRAHXQDYCSVYBZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|