C17H22O — CID 123148611
1,2,3,4,5,6,7,8,13,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 123148611) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,13,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | 1,2,3,4,5,6,7,8,13,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 123148611 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1,2,3,4,5,6,7,8,13,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | O=C1CC2C=CC3=C4CCCCC4CCC3C2C1 |
| InChI | InChI=1S/C17H22O/c18-13-9-12-6-8-15-14-4-2-1-3-11(14)5-7-16(15)17(12)10-13/h6,8,11-12,16-17H,1-5,7,9-10H2 |
| InChIKey | QFBUGQZDNZWALB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |