C28H41NO2 — CID 123148726
1-[4-[4-(4-ethylcyclohexyl)oxyphenyl]piperidin-1-yl]nona-7,8-dien-3-one (PubChem CID 123148726) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is 1-[4-[4-(4-ethylcyclohexyl)oxyphenyl]piperidin-1-yl]nona-7,8-dien-3-one.
| Compound Name | 1-[4-[4-(4-ethylcyclohexyl)oxyphenyl]piperidin-1-yl]nona-7,8-dien-3-one |
|---|---|
| PubChem CID | 123148726 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 1-[4-[4-(4-ethylcyclohexyl)oxyphenyl]piperidin-1-yl]nona-7,8-dien-3-one |
| SMILES | C=C=CCCCC(=O)CCN1CCC(c2ccc(OC3CCC(CC)CC3)cc2)CC1 |
| InChI | InChI=1S/C28H41NO2/c1-3-5-6-7-8-26(30)19-22-29-20-17-25(18-21-29)24-11-15-28(16-12-24)31-27-13-9-23(4-2)10-14-27/h5,11-12,15-16,23,25,27H,1,4,6-10,13-14,17-22H2,2H3 |
| InChIKey | BDCINXBONIGASX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|