About N-ethyl-2-iminoacetamide
N-ethyl-2-iminoacetamide (PubChem CID 123148971) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is N-ethyl-2-iminoacetamide.
Molecular Properties
| Compound Name | N-ethyl-2-iminoacetamide |
| PubChem CID | 123148971 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | N-ethyl-2-iminoacetamide |
| SMILES | [H]/N=C/C(=O)NCC |
| InChI | InChI=1S/C4H8N2O/c1-2-6-4(7)3-5/h3,5H,2H2,1H3,(H,6,7)/b5-3+ |
| InChIKey | MPSJCBKZTPJVLF-HWKANZROSA-N |
| XLogP | -0.23 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-iminoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-iminoacetamide?
The IUPAC name of N-ethyl-2-iminoacetamide (CID 123148971) is N-ethyl-2-iminoacetamide.
What is the SMILES notation for N-ethyl-2-iminoacetamide?
The canonical SMILES for N-ethyl-2-iminoacetamide is [H]/N=C/C(=O)NCC.
What is the InChIKey of N-ethyl-2-iminoacetamide?
The InChIKey is MPSJCBKZTPJVLF-HWKANZROSA-N. The full InChI is InChI=1S/C4H8N2O/c1-2-6-4(7)3-5/h3,5H,2H2,1H3,(H,6,7)/b5-3+.
What are the key properties of N-ethyl-2-iminoacetamide?
N-ethyl-2-iminoacetamide has a molecular weight of 100.12 g/mol, XLogP of -0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-iminoacetamide is sourced from PubChem (CID 123148971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).