C27H43N3O15 — CID 123148987
(2,5-dihydroxypyrrol-1-yl) 6-[[2-(4,16,17,18,20-pentahydroxy-5-methyl-2,6,8,14,19-pentaoxa-11-azatricyclo[13.3.1.13,7]icosan-11-yl)acetyl]amino]hexanoate (PubChem CID 123148987) has the molecular formula C27H43N3O15 and a molecular weight of 649.65 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[[2-(4,16,17,18,20-pentahydroxy-5-methyl-2,6,8,14,19-pentaoxa-11-azatricyclo[13.3.1.13,7]icosan-11-yl)acetyl]amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[[2-(4,16,17,18,20-pentahydroxy-5-methyl-2,6,8,14,19-pentaoxa-11-azatricyclo[13.3.1.13,7]icosan-11-yl)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 123148987 |
| Molecular Formula | C27H43N3O15 |
| Molecular Weight | 649.65 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[[2-(4,16,17,18,20-pentahydroxy-5-methyl-2,6,8,14,19-pentaoxa-11-azatricyclo[13.3.1.13,7]icosan-11-yl)acetyl]amino]hexanoate |
| SMILES | CC1OC2OCCN(CC(=O)NCCCCCC(=O)On3c(O)ccc3O)CCOC3OC(OC(C1O)C2O)C(O)C(O)C3O |
| InChI | InChI=1S/C27H43N3O15/c1-14-19(35)24-23(39)26(42-14)41-12-10-29(9-11-40-25-21(37)20(36)22(38)27(43-24)44-25)13-15(31)28-8-4-2-3-5-18(34)45-30-16(32)6-7-17(30)33/h6-7,14,19-27,32-33,35-39H,2-5,8-13H2,1H3,(H,28,31) |
| InChIKey | YUKKWCWQUGBLBU-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 251.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.65 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|