C21H24BrN5O2 — CID 123149060
(2R,5S)-4-(3-bromo-4-isocyanophenyl)-N-(2-methoxy-6-methyl-4-pyridinyl)-2,5-dimethylpiperazine-1-carboxamide (PubChem CID 123149060) has the molecular formula C21H24BrN5O2 and a molecular weight of 458.36 g/mol. Its IUPAC name is (2R,5S)-4-(3-bromo-4-isocyanophenyl)-N-(2-methoxy-6-methyl-4-pyridinyl)-2,5-dimethylpiperazine-1-carboxamide.
| Compound Name | (2R,5S)-4-(3-bromo-4-isocyanophenyl)-N-(2-methoxy-6-methyl-4-pyridinyl)-2,5-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 123149060 |
| Molecular Formula | C21H24BrN5O2 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (2R,5S)-4-(3-bromo-4-isocyanophenyl)-N-(2-methoxy-6-methyl-4-pyridinyl)-2,5-dimethylpiperazine-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(N2C[C@@H](C)N(C(=O)Nc3cc(C)nc(OC)c3)C[C@@H]2C)cc1Br |
| InChI | InChI=1S/C21H24BrN5O2/c1-13-8-16(9-20(24-13)29-5)25-21(28)27-12-14(2)26(11-15(27)3)17-6-7-19(23-4)18(22)10-17/h6-10,14-15H,11-12H2,1-3,5H3,(H,24,25,28)/t14-,15+/m0/s1 |
| InChIKey | IMYLICCCJVDXGW-LSDHHAIUSA-N |
| XLogP | 4.84 |
| TPSA | 62.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|