C18H24N2O4Si — CID 123149272
(3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-isocyano-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-1-one (PubChem CID 123149272) has the molecular formula C18H24N2O4Si and a molecular weight of 360.49 g/mol. Its IUPAC name is (3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-isocyano-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-1-one.
| Compound Name | (3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-isocyano-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-1-one |
|---|---|
| PubChem CID | 123149272 |
| Molecular Formula | C18H24N2O4Si |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-isocyano-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-1-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)OC[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)N21 |
| InChI | InChI=1S/C18H24N2O4Si/c1-18(2,3)25(5,6)23-11-16-14-10-22-15-9-12(19-4)7-8-13(15)20(14)17(21)24-16/h7-9,14,16H,10-11H2,1-3,5-6H3/t14-,16-/m0/s1 |
| InChIKey | PDZXTCPRIDCMJG-HOCLYGCPSA-N |
| XLogP | 4.35 |
| TPSA | 52.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|