C24H28ClN7O4S — CID 123149454
3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-6-[[3-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-4-yl]-4-methylbenzenesulfonic acid (PubChem CID 123149454) has the molecular formula C24H28ClN7O4S and a molecular weight of 546.05 g/mol. Its IUPAC name is 3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-6-[[3-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-4-yl]-4-methylbenzenesulfonic acid.
| Compound Name | 3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-6-[[3-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-4-yl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 123149454 |
| Molecular Formula | C24H28ClN7O4S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-6-[[3-(prop-2-enoylamino)cyclohexyl]amino]pyrimidin-4-yl]-4-methylbenzenesulfonic acid |
| SMILES | C=CC(=O)NC1CCCC(Nc2nc(Nc3cnn(C)c3)nc(-c3cc(S(=O)(=O)O)ccc3C)c2Cl)C1 |
| InChI | InChI=1S/C24H28ClN7O4S/c1-4-20(33)27-15-6-5-7-16(10-15)28-23-21(25)22(19-11-18(37(34,35)36)9-8-14(19)2)30-24(31-23)29-17-12-26-32(3)13-17/h4,8-9,11-13,15-16H,1,5-7,10H2,2-3H3,(H,27,33)(H,34,35,36)(H2,28,29,30,31) |
| InChIKey | UWFWQVPNPTXGGE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|