C19H24F3N3O — CID 123149710
2-isocyano-6-methyl-4-[2-[(1S,2R)-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]cyclopropyl]ethoxy]pyridine (PubChem CID 123149710) has the molecular formula C19H24F3N3O and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-isocyano-6-methyl-4-[2-[(1S,2R)-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]cyclopropyl]ethoxy]pyridine.
| Compound Name | 2-isocyano-6-methyl-4-[2-[(1S,2R)-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]cyclopropyl]ethoxy]pyridine |
|---|---|
| PubChem CID | 123149710 |
| Molecular Formula | C19H24F3N3O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-isocyano-6-methyl-4-[2-[(1S,2R)-2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]cyclopropyl]ethoxy]pyridine |
| SMILES | [C-]#[N+]c1cc(OCC[C@@H]2C[C@@H]2C2CCN(CC(F)(F)F)CC2)cc(C)n1 |
| InChI | InChI=1S/C19H24F3N3O/c1-13-9-16(11-18(23-2)24-13)26-8-5-15-10-17(15)14-3-6-25(7-4-14)12-19(20,21)22/h9,11,14-15,17H,3-8,10,12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | RFRRZTQNAXISET-NVXWUHKLSA-N |
| XLogP | 4.62 |
| TPSA | 29.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|