C14H28N2O2Si — CID 123149781
[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-ethyl-dimethylsilane (PubChem CID 123149781) has the molecular formula C14H28N2O2Si and a molecular weight of 284.48 g/mol. Its IUPAC name is [(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-ethyl-dimethylsilane.
| Compound Name | [(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 123149781 |
| Molecular Formula | C14H28N2O2Si |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-ethyl-dimethylsilane |
| SMILES | CC[Si](C)(C)C[C@@H]1N=C(OC)[C@@H](C(C)C)N=C1OC |
| InChI | InChI=1S/C14H28N2O2Si/c1-8-19(6,7)9-11-13(17-4)16-12(10(2)3)14(15-11)18-5/h10-12H,8-9H2,1-7H3/t11-,12+/m0/s1 |
| InChIKey | UKZQUCUCTMTEKI-NWDGAFQWSA-N |
| XLogP | 3.21 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|