About 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial
2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial (PubChem CID 123149871) has the molecular formula C10H14F3NS
and a molecular weight of 237.29 g/mol. Its IUPAC name is 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial.
Molecular Properties
| Compound Name | 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial |
| PubChem CID | 123149871 |
| Molecular Formula | C10H14F3NS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial |
| SMILES | [H]/N=C(\C=S)C(C)CC(=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NS/c1-6(2)8(10(11,12)13)4-7(3)9(14)5-15/h5,7,14H,4H2,1-3H3/b14-9+ |
| InChIKey | PSQLDKDLKVRTGS-NTEUORMPSA-N |
| XLogP | 3.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial?
The IUPAC name of 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial (CID 123149871) is 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial.
What is the SMILES notation for 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial?
The canonical SMILES for 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial is [H]/N=C(\C=S)C(C)CC(=C(C)C)C(F)(F)F.
What is the InChIKey of 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial?
The InChIKey is PSQLDKDLKVRTGS-NTEUORMPSA-N. The full InChI is InChI=1S/C10H14F3NS/c1-6(2)8(10(11,12)13)4-7(3)9(14)5-15/h5,7,14H,4H2,1-3H3/b14-9+.
What are the key properties of 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial?
2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial has a molecular weight of 237.29 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-3,6-dimethyl-5-(trifluoromethyl)hept-5-enethial is sourced from PubChem (CID 123149871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).