C18H29N5O3S2 — CID 123149993
2-acetamido-5-[[5-(2,3-dimethylbutyl)-1H-imidazol-4-yl]disulfanyl]-4,5-bis(methylimino)pentanoic acid (PubChem CID 123149993) has the molecular formula C18H29N5O3S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is 2-acetamido-5-[[5-(2,3-dimethylbutyl)-1H-imidazol-4-yl]disulfanyl]-4,5-bis(methylimino)pentanoic acid.
| Compound Name | 2-acetamido-5-[[5-(2,3-dimethylbutyl)-1H-imidazol-4-yl]disulfanyl]-4,5-bis(methylimino)pentanoic acid |
|---|---|
| PubChem CID | 123149993 |
| Molecular Formula | C18H29N5O3S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-acetamido-5-[[5-(2,3-dimethylbutyl)-1H-imidazol-4-yl]disulfanyl]-4,5-bis(methylimino)pentanoic acid |
| SMILES | C/N=C(CC(NC(C)=O)C(=O)O)\C(=N/C)SSc1nc[nH]c1CC(C)C(C)C |
| InChI | InChI=1S/C18H29N5O3S2/c1-10(2)11(3)7-14-17(22-9-21-14)28-27-16(20-6)13(19-5)8-15(18(25)26)23-12(4)24/h9-11,15H,7-8H2,1-6H3,(H,21,22)(H,23,24)(H,25,26)/b19-13-,20-16+ |
| InChIKey | AQARIERMAPLILE-GTCQVGLTSA-N |
| XLogP | 3.06 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|