C45H34N2OSSi — CID 123150286
2-dibenzothiophen-2-yl-4-pyridin-2-yl-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)pyridine (PubChem CID 123150286) has the molecular formula C45H34N2OSSi and a molecular weight of 678.93 g/mol. Its IUPAC name is 2-dibenzothiophen-2-yl-4-pyridin-2-yl-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)pyridine.
| Compound Name | 2-dibenzothiophen-2-yl-4-pyridin-2-yl-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)pyridine |
|---|---|
| PubChem CID | 123150286 |
| Molecular Formula | C45H34N2OSSi |
| Molecular Weight | 678.93 g/mol |
| Exact Mass | 678.22 |
| IUPAC Name | 2-dibenzothiophen-2-yl-4-pyridin-2-yl-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)pyridine |
| SMILES | CC1(C)c2ccccc2-c2c1ccc1c2Oc2c(-c3cc(-c4ccccn4)cc(-c4ccc5sc6ccccc6c5c4)n3)cccc2[Si]1(C)C |
| InChI | InChI=1S/C45H34N2OSSi/c1-45(2)33-15-7-5-13-30(33)42-34(45)20-22-41-44(42)48-43-31(14-11-18-40(43)50(41,3)4)37-26-28(35-16-9-10-23-46-35)25-36(47-37)27-19-21-39-32(24-27)29-12-6-8-17-38(29)49-39/h5-26H,1-4H3 |
| InChIKey | MHJPWOGOGDCVKP-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.93 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|