C29H40N5O2+ — CID 123150322
4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1,1-dimethylimidazol-1-ium-2-carboxamide (PubChem CID 123150322) has the molecular formula C29H40N5O2+ and a molecular weight of 490.67 g/mol. Its IUPAC name is 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1,1-dimethylimidazol-1-ium-2-carboxamide.
| Compound Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1,1-dimethylimidazol-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 123150322 |
| Molecular Formula | C29H40N5O2+ |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1,1-dimethylimidazol-1-ium-2-carboxamide |
| SMILES | CC1(C)CC=C(c2nc(C3CC(C)(C)OC(C)(C)C3)ccc2NC(=O)C2=NC(C#N)=C[N+]2(C)C)CC1 |
| InChI | InChI=1S/C29H39N5O2/c1-27(2)13-11-19(12-14-27)24-23(33-26(35)25-31-21(17-30)18-34(25,7)8)10-9-22(32-24)20-15-28(3,4)36-29(5,6)16-20/h9-11,18,20H,12-16H2,1-8H3/p+1 |
| InChIKey | ATVLPAHRSLOTGL-UHFFFAOYSA-O |
| XLogP | 5.92 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|