C27H40O4 — CID 123150728
[(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] hexanoate (PubChem CID 123150728) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is [(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] hexanoate.
| Compound Name | [(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] hexanoate |
|---|---|
| PubChem CID | 123150728 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | [(10R,13S,17R)-17-acetyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1CC(=O)C=C2CCC3C(CC[C@@]4(C)C3CC[C@H]4C(C)=O)[C@]21C |
| InChI | InChI=1S/C27H40O4/c1-5-6-7-8-25(30)31-24-16-19(29)15-18-9-10-20-22-12-11-21(17(2)28)26(22,3)14-13-23(20)27(18,24)4/h15,20-24H,5-14,16H2,1-4H3/t20?,21-,22?,23?,24?,26+,27-/m0/s1 |
| InChIKey | QRBQVZBJIUCHCA-ZSADFHTOSA-N |
| XLogP | 5.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|