About 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium
2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium (PubChem CID 123150805) has the molecular formula C13H16N2O6P+
and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium |
| PubChem CID | 123150805 |
| Molecular Formula | C13H16N2O6P+ |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium |
| SMILES | O=C(CC[P+](=O)CCN1C(=O)C=CC1=O)ON1CCCC1=O |
| InChI | InChI=1S/C13H16N2O6P/c16-10-3-4-11(17)14(10)7-9-22(20)8-5-13(19)21-15-6-1-2-12(15)18/h3-4H,1-2,5-9H2/q+1 |
| InChIKey | OEHSNTBPFRTAGW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium (CID 123150805) is 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium is O=C(CC[P+](=O)CCN1C(=O)C=CC1=O)ON1CCCC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium?
The InChIKey is OEHSNTBPFRTAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O6P/c16-10-3-4-11(17)14(10)7-9-22(20)8-5-13(19)21-15-6-1-2-12(15)18/h3-4H,1-2,5-9H2/q+1.
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium?
2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium has a molecular weight of 327.25 g/mol, XLogP of 0.21, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)ethyl-oxo-[3-oxo-3-(2-oxopyrrolidin-1-yl)oxypropyl]phosphanium is sourced from PubChem (CID 123150805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).