C14H15N5O2 — CID 123150819
N-(1-aminoethylidene)-13-methyl-9-oxa-3,6,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaene-4-carboxamide (PubChem CID 123150819) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-(1-aminoethylidene)-13-methyl-9-oxa-3,6,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaene-4-carboxamide.
| Compound Name | N-(1-aminoethylidene)-13-methyl-9-oxa-3,6,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 123150819 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(1-aminoethylidene)-13-methyl-9-oxa-3,6,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2,4,11,13-pentaene-4-carboxamide |
| SMILES | C/C(N)=N\C(=O)c1cn2c(n1)-c1cc(C)ncc1OCC2 |
| InChI | InChI=1S/C14H15N5O2/c1-8-5-10-12(6-16-8)21-4-3-19-7-11(18-13(10)19)14(20)17-9(2)15/h5-7H,3-4H2,1-2H3,(H2,15,17,20) |
| InChIKey | ABFMRKZYLQCORJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|