C32H42O5S — CID 123151000
11-[4-(3-hydroxyprop-1-ynyl)phenyl]-5',5'-dimethyl-17-(sulfanylmethyl)spiro[1,2,4,6,7,8,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5,17-diol (PubChem CID 123151000) has the molecular formula C32H42O5S and a molecular weight of 538.75 g/mol. Its IUPAC name is 11-[4-(3-hydroxyprop-1-ynyl)phenyl]-5',5'-dimethyl-17-(sulfanylmethyl)spiro[1,2,4,6,7,8,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5,17-diol.
| Compound Name | 11-[4-(3-hydroxyprop-1-ynyl)phenyl]-5',5'-dimethyl-17-(sulfanylmethyl)spiro[1,2,4,6,7,8,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5,17-diol |
|---|---|
| PubChem CID | 123151000 |
| Molecular Formula | C32H42O5S |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 11-[4-(3-hydroxyprop-1-ynyl)phenyl]-5',5'-dimethyl-17-(sulfanylmethyl)spiro[1,2,4,6,7,8,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5,17-diol |
| SMILES | CC1(C)COC2(CCC3=C4C(c5ccc(C#CCO)cc5)CC5C(CCC5(O)CS)C4CCC3(O)C2)OC1 |
| InChI | InChI=1S/C32H42O5S/c1-29(2)18-36-32(37-19-29)14-11-26-28-24(10-12-30(26,34)17-32)23-9-13-31(35,20-38)27(23)16-25(28)22-7-5-21(6-8-22)4-3-15-33/h5-8,23-25,27,33-35,38H,9-20H2,1-2H3 |
| InChIKey | DRLJNSFMQKIFFF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|