C22H34FNOSSi — CID 123151054
(R)-N-[1-(2-fluorophenyl)-3-tri(propan-2-yl)silylprop-2-ynylidene]-2-methylpropane-2-sulfinamide (PubChem CID 123151054) has the molecular formula C22H34FNOSSi and a molecular weight of 407.67 g/mol. Its IUPAC name is (R)-N-[1-(2-fluorophenyl)-3-tri(propan-2-yl)silylprop-2-ynylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[1-(2-fluorophenyl)-3-tri(propan-2-yl)silylprop-2-ynylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123151054 |
| Molecular Formula | C22H34FNOSSi |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (R)-N-[1-(2-fluorophenyl)-3-tri(propan-2-yl)silylprop-2-ynylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)[Si](C#CC(=N[S@](=O)C(C)(C)C)c1ccccc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H34FNOSSi/c1-16(2)27(17(3)4,18(5)6)15-14-21(24-26(25)22(7,8)9)19-12-10-11-13-20(19)23/h10-13,16-18H,1-9H3/t26-/m1/s1 |
| InChIKey | TYCCNXDIGIYJJM-AREMUKBSSA-N |
| XLogP | 6.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|