About [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate
[2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate (PubChem CID 123151259) has the molecular formula C24H23N3O2
and a molecular weight of 385.47 g/mol. Its IUPAC name is [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate.
Molecular Properties
| Compound Name | [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate |
| PubChem CID | 123151259 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate |
| SMILES | CCC=Cc1ccnc(-c2cc(OC=O)cc(-c3cc(C=CCC)ccn3)n2)c1 |
| InChI | InChI=1S/C24H23N3O2/c1-3-5-7-18-9-11-25-21(13-18)23-15-20(29-17-28)16-24(27-23)22-14-19(8-6-4-2)10-12-26-22/h5-17H,3-4H2,1-2H3 |
| InChIKey | FGUBQGRXCBHZLX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate?
The IUPAC name of [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate (CID 123151259) is [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate.
What is the SMILES notation for [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate?
The canonical SMILES for [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate is CCC=Cc1ccnc(-c2cc(OC=O)cc(-c3cc(C=CCC)ccn3)n2)c1.
What is the InChIKey of [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate?
The InChIKey is FGUBQGRXCBHZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O2/c1-3-5-7-18-9-11-25-21(13-18)23-15-20(29-17-28)16-24(27-23)22-14-19(8-6-4-2)10-12-26-22/h5-17H,3-4H2,1-2H3.
What are the key properties of [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate?
[2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate has a molecular weight of 385.47 g/mol, XLogP of 5.59, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(4-but-1-enyl-2-pyridinyl)-4-pyridinyl] formate is sourced from PubChem (CID 123151259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).