C18H19F2N3 — CID 123151742
N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydro-1H-isoindole-4-carboximidamide (PubChem CID 123151742) has the molecular formula C18H19F2N3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydro-1H-isoindole-4-carboximidamide.
| Compound Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydro-1H-isoindole-4-carboximidamide |
|---|---|
| PubChem CID | 123151742 |
| Molecular Formula | C18H19F2N3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydro-1H-isoindole-4-carboximidamide |
| SMILES | CC(F)(F)c1ccc(C/N=C(\N)c2cccc3c2CNC3)cc1 |
| InChI | InChI=1S/C18H19F2N3/c1-18(19,20)14-7-5-12(6-8-14)9-23-17(21)15-4-2-3-13-10-22-11-16(13)15/h2-8,22H,9-11H2,1H3,(H2,21,23) |
| InChIKey | JNYOVPRUTXJQDS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|