C55H51N11O2 — CID 123152195
2-phenyl-5-[4-phenyl-3-[6-(4-pyridin-3-yltriazol-1-yl)hexylcarbamoylamino]phenyl]-N-[2-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]ethyl]benzamide (PubChem CID 123152195) has the molecular formula C55H51N11O2 and a molecular weight of 898.09 g/mol. Its IUPAC name is 2-phenyl-5-[4-phenyl-3-[6-(4-pyridin-3-yltriazol-1-yl)hexylcarbamoylamino]phenyl]-N-[2-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]ethyl]benzamide.
| Compound Name | 2-phenyl-5-[4-phenyl-3-[6-(4-pyridin-3-yltriazol-1-yl)hexylcarbamoylamino]phenyl]-N-[2-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 123152195 |
| Molecular Formula | C55H51N11O2 |
| Molecular Weight | 898.09 g/mol |
| Exact Mass | 897.42 |
| IUPAC Name | 2-phenyl-5-[4-phenyl-3-[6-(4-pyridin-3-yltriazol-1-yl)hexylcarbamoylamino]phenyl]-N-[2-[4-[(4-pyridin-3-yltriazol-1-yl)methyl]phenyl]ethyl]benzamide |
| SMILES | O=C(NCCCCCCn1cc(-c2cccnc2)nn1)Nc1cc(-c2ccc(-c3ccccc3)c(C(=O)NCCc3ccc(Cn4cc(-c5cccnc5)nn4)cc3)c2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C55H51N11O2/c67-54(58-31-27-40-19-21-41(22-20-40)37-66-39-53(62-64-66)47-18-12-29-57-36-47)50-33-44(23-25-48(50)42-13-5-3-6-14-42)45-24-26-49(43-15-7-4-8-16-43)51(34-45)60-55(68)59-30-9-1-2-10-32-65-38-52(61-63-65)46-17-11-28-56-35-46/h3-8,11-26,28-29,33-36,38-39H,1-2,9-10,27,30-32,37H2,(H,58,67)(H2,59,60,68) |
| InChIKey | YRVLZZHBDHSXPJ-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.09 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|