C21H34O4 — CID 123152244
(2R)-2-hydroxy-4-(1-hydroxy-2-methylbutyl)-6-(3-methylbut-2-enyl)-2-(3-methylbutyl)cyclohex-4-ene-1,3-dione (PubChem CID 123152244) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2R)-2-hydroxy-4-(1-hydroxy-2-methylbutyl)-6-(3-methylbut-2-enyl)-2-(3-methylbutyl)cyclohex-4-ene-1,3-dione.
| Compound Name | (2R)-2-hydroxy-4-(1-hydroxy-2-methylbutyl)-6-(3-methylbut-2-enyl)-2-(3-methylbutyl)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 123152244 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2R)-2-hydroxy-4-(1-hydroxy-2-methylbutyl)-6-(3-methylbut-2-enyl)-2-(3-methylbutyl)cyclohex-4-ene-1,3-dione |
| SMILES | CCC(C)C(O)C1=CC(CC=C(C)C)C(=O)[C@](O)(CCC(C)C)C1=O |
| InChI | InChI=1S/C21H34O4/c1-7-15(6)18(22)17-12-16(9-8-13(2)3)19(23)21(25,20(17)24)11-10-14(4)5/h8,12,14-16,18,22,25H,7,9-11H2,1-6H3/t15?,16?,18?,21-/m1/s1 |
| InChIKey | KPQIKHRZEWAWLZ-TZMLOSDDSA-N |
| XLogP | 3.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|