C17H17N3 — CID 123152620
3-(2,3-dihydropyridin-5-yl)-1-(5-methylhexa-3,5-dien-1-yn-3-yl)-6-methylidenepyridazine (PubChem CID 123152620) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-(2,3-dihydropyridin-5-yl)-1-(5-methylhexa-3,5-dien-1-yn-3-yl)-6-methylidenepyridazine.
| Compound Name | 3-(2,3-dihydropyridin-5-yl)-1-(5-methylhexa-3,5-dien-1-yn-3-yl)-6-methylidenepyridazine |
|---|---|
| PubChem CID | 123152620 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-(2,3-dihydropyridin-5-yl)-1-(5-methylhexa-3,5-dien-1-yn-3-yl)-6-methylidenepyridazine |
| SMILES | C#CC(=CC(=C)C)N1N=C(C2=CCCN=C2)C=CC1=C |
| InChI | InChI=1S/C17H17N3/c1-5-16(11-13(2)3)20-14(4)8-9-17(19-20)15-7-6-10-18-12-15/h1,7-9,11-12H,2,4,6,10H2,3H3 |
| InChIKey | JXNPMFLKVFHMKL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|