C41H64O8 — CID 123153513
(22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) 2,3,3-trimethylpent-4-yn-2-yl carbonate (PubChem CID 123153513) has the molecular formula C41H64O8 and a molecular weight of 684.96 g/mol. Its IUPAC name is (22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) 2,3,3-trimethylpent-4-yn-2-yl carbonate.
| Compound Name | (22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) 2,3,3-trimethylpent-4-yn-2-yl carbonate |
|---|---|
| PubChem CID | 123153513 |
| Molecular Formula | C41H64O8 |
| Molecular Weight | 684.96 g/mol |
| Exact Mass | 684.46 |
| IUPAC Name | (22-hexa-3,5-dien-2-yl-8,14,20-trihydroxy-7,13,15,17,21-pentamethyl-2-oxo-1-oxacyclodocosa-3,5,11-trien-10-yl) 2,3,3-trimethylpent-4-yn-2-yl carbonate |
| SMILES | C#CC(C)(C)C(C)(C)OC(=O)OC1C=CC(C)C(O)C(C)CC(C)CCC(O)C(C)C(C(C)C=CC=C)OC(=O)C=CC=CC(C)C(O)C1 |
| InChI | InChI=1S/C41H64O8/c1-13-15-18-30(6)38-32(8)34(42)24-21-27(3)25-31(7)37(45)29(5)22-23-33(47-39(46)49-41(11,12)40(9,10)14-2)26-35(43)28(4)19-16-17-20-36(44)48-38/h2,13,15-20,22-23,27-35,37-38,42-43,45H,1,21,24-26H2,3-12H3 |
| InChIKey | PNGOHNMHDPLEIY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.96 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|