About tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate
tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate (PubChem CID 123153532) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate |
| PubChem CID | 123153532 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(N=O)c2ccccc2OC12CCNCC2 |
| InChI | InChI=1S/C18H24N2O4/c1-17(2,3)24-16(21)14-15(20-22)12-6-4-5-7-13(12)23-18(14)8-10-19-11-9-18/h4-7,14-15,19H,8-11H2,1-3H3 |
| InChIKey | YWMXJCXGMMENFG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate?
The IUPAC name of tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate (CID 123153532) is tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate.
What is the SMILES notation for tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate?
The canonical SMILES for tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate is CC(C)(C)OC(=O)C1C(N=O)c2ccccc2OC12CCNCC2.
What is the InChIKey of tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate?
The InChIKey is YWMXJCXGMMENFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4/c1-17(2,3)24-16(21)14-15(20-22)12-6-4-5-7-13(12)23-18(14)8-10-19-11-9-18/h4-7,14-15,19H,8-11H2,1-3H3.
What are the key properties of tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate?
tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate has a molecular weight of 332.40 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-nitrosospiro[3,4-dihydrochromene-2,4'-piperidine]-3-carboxylate is sourced from PubChem (CID 123153532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).